C13H20O3S — CID 139843459
2,3-dimethylbutan-2-yl 4-methylbenzenesulfonate (PubChem CID 139843459) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl 4-methylbenzenesulfonate.
| Compound Name | 2,3-dimethylbutan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139843459 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2,3-dimethylbutan-2-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)(C)C(C)C)cc1 |
| InChI | InChI=1S/C13H20O3S/c1-10(2)13(4,5)16-17(14,15)12-8-6-11(3)7-9-12/h6-10H,1-5H3 |
| InChIKey | NOWOFLALNHGNMO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|