C10H8F6O3S — CID 53406027
1,1,1,2,3,3-hexafluoropropan-2-yl 4-methylbenzenesulfonate (PubChem CID 53406027) has the molecular formula C10H8F6O3S and a molecular weight of 322.23 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoropropan-2-yl 4-methylbenzenesulfonate.
| Compound Name | 1,1,1,2,3,3-hexafluoropropan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 53406027 |
| Molecular Formula | C10H8F6O3S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoropropan-2-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(F)(C(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F6O3S/c1-6-2-4-7(5-3-6)20(17,18)19-9(13,8(11)12)10(14,15)16/h2-5,8H,1H3 |
| InChIKey | YMMQTRKTHVEGIN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|