C17H16ClF3O3S2 — CID 102436970
[2-(3-chloro-4-methylsulfanylphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate (PubChem CID 102436970) has the molecular formula C17H16ClF3O3S2 and a molecular weight of 424.89 g/mol. Its IUPAC name is [2-(3-chloro-4-methylsulfanylphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-(3-chloro-4-methylsulfanylphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102436970 |
| Molecular Formula | C17H16ClF3O3S2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | [2-(3-chloro-4-methylsulfanylphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CSc1ccc(C(C)(OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H16ClF3O3S2/c1-11-4-7-13(8-5-11)26(22,23)24-16(2,17(19,20)21)12-6-9-15(25-3)14(18)10-12/h4-10H,1-3H3 |
| InChIKey | DRDOVAOUVFWVDD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|