About 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine
2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine (PubChem CID 105424576) has the molecular formula C12H18ClNS
and a molecular weight of 243.80 g/mol. Its IUPAC name is 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine |
| PubChem CID | 105424576 |
| Molecular Formula | C12H18ClNS |
| Molecular Weight | 243.80 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)(C)c1ccc(SC)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClNS/c1-12(2,8-14-3)9-5-6-11(15-4)10(13)7-9/h5-7,14H,8H2,1-4H3 |
| InChIKey | ZXUZSHBPLYVCID-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine?
The IUPAC name of 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine (CID 105424576) is 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine?
The canonical SMILES for 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine is CNCC(C)(C)c1ccc(SC)c(Cl)c1.
What is the InChIKey of 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine?
The InChIKey is ZXUZSHBPLYVCID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClNS/c1-12(2,8-14-3)9-5-6-11(15-4)10(13)7-9/h5-7,14H,8H2,1-4H3.
What are the key properties of 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine?
2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine has a molecular weight of 243.80 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4-methylsulfanylphenyl)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 105424576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).