C12H17Cl2N — CID 79830214
3-(3,4-dichlorophenyl)-N,3-dimethylbutan-1-amine (PubChem CID 79830214) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N,3-dimethylbutan-1-amine.
| Compound Name | 3-(3,4-dichlorophenyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 79830214 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N,3-dimethylbutan-1-amine |
| SMILES | CNCCC(C)(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N/c1-12(2,6-7-15-3)9-4-5-10(13)11(14)8-9/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | VDTWKFAALFENGZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |