About 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol
6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol (PubChem CID 123305021) has the molecular formula C16H25Cl2NO
and a molecular weight of 318.29 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol.
Molecular Properties
| Compound Name | 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol |
| PubChem CID | 123305021 |
| Molecular Formula | C16H25Cl2NO |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol |
| SMILES | CCC(C)(O)CCC(C)(CNC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H25Cl2NO/c1-5-16(3,20)9-8-15(2,11-19-4)12-6-7-13(17)14(18)10-12/h6-7,10,19-20H,5,8-9,11H2,1-4H3 |
| InChIKey | CEDKFUUCKFKZKI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol?
The IUPAC name of 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol (CID 123305021) is 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol.
What is the SMILES notation for 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol?
The canonical SMILES for 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol is CCC(C)(O)CCC(C)(CNC)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol?
The InChIKey is CEDKFUUCKFKZKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25Cl2NO/c1-5-16(3,20)9-8-15(2,11-19-4)12-6-7-13(17)14(18)10-12/h6-7,10,19-20H,5,8-9,11H2,1-4H3.
What are the key properties of 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol?
6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol has a molecular weight of 318.29 g/mol, XLogP of 4.41, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dichlorophenyl)-3,6-dimethyl-7-(methylamino)heptan-3-ol is sourced from PubChem (CID 123305021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).