About 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine
3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine (PubChem CID 113319299) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine |
| PubChem CID | 113319299 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine |
| SMILES | CCc1ccc(C(C)(C)CCNC)cc1CC |
| InChI | InChI=1S/C16H27N/c1-6-13-8-9-15(12-14(13)7-2)16(3,4)10-11-17-5/h8-9,12,17H,6-7,10-11H2,1-5H3 |
| InChIKey | GNEIFCXEYJUZMR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine?
The IUPAC name of 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine (CID 113319299) is 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine.
What is the SMILES notation for 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine?
The canonical SMILES for 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine is CCc1ccc(C(C)(C)CCNC)cc1CC.
What is the InChIKey of 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine?
The InChIKey is GNEIFCXEYJUZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-6-13-8-9-15(12-14(13)7-2)16(3,4)10-11-17-5/h8-9,12,17H,6-7,10-11H2,1-5H3.
What are the key properties of 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine?
3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine has a molecular weight of 233.40 g/mol, XLogP of 3.70, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-diethylphenyl)-N,3-dimethylbutan-1-amine is sourced from PubChem (CID 113319299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).