C14H25N — CID 164855873
1,2-diethyl-4-methylbenzene;N-methylethanamine (PubChem CID 164855873) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1,2-diethyl-4-methylbenzene;N-methylethanamine.
| Compound Name | 1,2-diethyl-4-methylbenzene;N-methylethanamine |
|---|---|
| PubChem CID | 164855873 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1,2-diethyl-4-methylbenzene;N-methylethanamine |
| SMILES | CCNC.CCc1ccc(C)cc1CC |
| InChI | InChI=1S/C11H16.C3H9N/c1-4-10-7-6-9(3)8-11(10)5-2;1-3-4-2/h6-8H,4-5H2,1-3H3;4H,3H2,1-2H3 |
| InChIKey | XOPHPBBVDCJDRK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |