C13H23N — CID 143835073
N,2-diethyl-5-methylaniline;ethane (PubChem CID 143835073) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is N,2-diethyl-5-methylaniline;ethane.
| Compound Name | N,2-diethyl-5-methylaniline;ethane |
|---|---|
| PubChem CID | 143835073 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N,2-diethyl-5-methylaniline;ethane |
| SMILES | CC.CCNc1cc(C)ccc1CC |
| InChI | InChI=1S/C11H17N.C2H6/c1-4-10-7-6-9(3)8-11(10)12-5-2;1-2/h6-8,12H,4-5H2,1-3H3;1-2H3 |
| InChIKey | RDMWCRJYOZNPNJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |