C11H18N2 — CID 59688677
1-N-ethyl-2-N,2-N,4-trimethylbenzene-1,2-diamine (PubChem CID 59688677) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-N-ethyl-2-N,2-N,4-trimethylbenzene-1,2-diamine.
| Compound Name | 1-N-ethyl-2-N,2-N,4-trimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 59688677 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-N-ethyl-2-N,2-N,4-trimethylbenzene-1,2-diamine |
| SMILES | CCNc1ccc(C)cc1N(C)C |
| InChI | InChI=1S/C11H18N2/c1-5-12-10-7-6-9(2)8-11(10)13(3)4/h6-8,12H,5H2,1-4H3 |
| InChIKey | LLYOUKJSMBIIGL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |