C16H30 — CID 143347602
1-ethyl-2,4-dimethylbenzene;propane (PubChem CID 143347602) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethylbenzene;propane.
| Compound Name | 1-ethyl-2,4-dimethylbenzene;propane |
|---|---|
| PubChem CID | 143347602 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 1-ethyl-2,4-dimethylbenzene;propane |
| SMILES | CCC.CCC.CCc1ccc(C)cc1C |
| InChI | InChI=1S/C10H14.2C3H8/c1-4-10-6-5-8(2)7-9(10)3;2*1-3-2/h5-7H,4H2,1-3H3;2*3H2,1-2H3 |
| InChIKey | BSMYFUSJZYJSSC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |