C12H19N — CID 62801673
2-(2,4-dimethylphenyl)-N-ethylethanamine (PubChem CID 62801673) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-ethylethanamine.
| Compound Name | 2-(2,4-dimethylphenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 62801673 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-ethylethanamine |
| SMILES | CCNCCc1ccc(C)cc1C |
| InChI | InChI=1S/C12H19N/c1-4-13-8-7-12-6-5-10(2)9-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | PZDWAJQIRRAIGW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|