C17H30 — CID 165130204
but-1-ene;2,4-dimethyl-1-propylbenzene;ethane (PubChem CID 165130204) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is but-1-ene;2,4-dimethyl-1-propylbenzene;ethane.
| Compound Name | but-1-ene;2,4-dimethyl-1-propylbenzene;ethane |
|---|---|
| PubChem CID | 165130204 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | but-1-ene;2,4-dimethyl-1-propylbenzene;ethane |
| SMILES | C=CCC.CC.CCCc1ccc(C)cc1C |
| InChI | InChI=1S/C11H16.C4H8.C2H6/c1-4-5-11-7-6-9(2)8-10(11)3;1-3-4-2;1-2/h6-8H,4-5H2,1-3H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | RKUWHWDOGYXWET-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|