C15H22 — CID 91041017
1-hept-6-enyl-2,4-dimethylbenzene (PubChem CID 91041017) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-hept-6-enyl-2,4-dimethylbenzene.
| Compound Name | 1-hept-6-enyl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 91041017 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-hept-6-enyl-2,4-dimethylbenzene |
| SMILES | C=CCCCCCc1ccc(C)cc1C |
| InChI | InChI=1S/C15H22/c1-4-5-6-7-8-9-15-11-10-13(2)12-14(15)3/h4,10-12H,1,5-9H2,2-3H3 |
| InChIKey | OJXRSEGQDZIZQI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|