C16H24Cl2OS — CID 67875252
2,4-dichloro-1-oct-7-enylbenzene;methylsulfinylmethane (PubChem CID 67875252) has the molecular formula C16H24Cl2OS and a molecular weight of 335.34 g/mol. Its IUPAC name is 2,4-dichloro-1-oct-7-enylbenzene;methylsulfinylmethane.
| Compound Name | 2,4-dichloro-1-oct-7-enylbenzene;methylsulfinylmethane |
|---|---|
| PubChem CID | 67875252 |
| Molecular Formula | C16H24Cl2OS |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2,4-dichloro-1-oct-7-enylbenzene;methylsulfinylmethane |
| SMILES | C=CCCCCCCc1ccc(Cl)cc1Cl.CS(C)=O |
| InChI | InChI=1S/C14H18Cl2.C2H6OS/c1-2-3-4-5-6-7-8-12-9-10-13(15)11-14(12)16;1-4(2)3/h2,9-11H,1,3-8H2;1-2H3 |
| InChIKey | WWHIASVWSHPARK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|