C13H18Cl2S — CID 10731219
7-(2,4-dichlorophenyl)heptane-1-thiol (PubChem CID 10731219) has the molecular formula C13H18Cl2S and a molecular weight of 277.26 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)heptane-1-thiol.
| Compound Name | 7-(2,4-dichlorophenyl)heptane-1-thiol |
|---|---|
| PubChem CID | 10731219 |
| Molecular Formula | C13H18Cl2S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 7-(2,4-dichlorophenyl)heptane-1-thiol |
| SMILES | SCCCCCCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2S/c14-12-8-7-11(13(15)10-12)6-4-2-1-3-5-9-16/h7-8,10,16H,1-6,9H2 |
| InChIKey | DMHUDWGFOUQWDR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|