C20H22Cl4S2 — CID 5078531
2,4-dichloro-1-[6-[(2,4-dichlorophenyl)methylsulfanyl]hexylsulfanylmethyl]benzene (PubChem CID 5078531) has the molecular formula C20H22Cl4S2 and a molecular weight of 468.34 g/mol. Its IUPAC name is 2,4-dichloro-1-[6-[(2,4-dichlorophenyl)methylsulfanyl]hexylsulfanylmethyl]benzene.
| Compound Name | 2,4-dichloro-1-[6-[(2,4-dichlorophenyl)methylsulfanyl]hexylsulfanylmethyl]benzene |
|---|---|
| PubChem CID | 5078531 |
| Molecular Formula | C20H22Cl4S2 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 2,4-dichloro-1-[6-[(2,4-dichlorophenyl)methylsulfanyl]hexylsulfanylmethyl]benzene |
| SMILES | Clc1ccc(CSCCCCCCSCc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl4S2/c21-17-7-5-15(19(23)11-17)13-25-9-3-1-2-4-10-26-14-16-6-8-18(22)12-20(16)24/h5-8,11-12H,1-4,9-10,13-14H2 |
| InChIKey | NOINSBVEUGSLFY-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|