C14H22Cl3NS — CID 3031212
3-[(2,4-dichlorophenyl)methylsulfanyl]-N,N-diethylpropan-1-amine;hydrochloride (PubChem CID 3031212) has the molecular formula C14H22Cl3NS and a molecular weight of 342.76 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methylsulfanyl]-N,N-diethylpropan-1-amine;hydrochloride.
| Compound Name | 3-[(2,4-dichlorophenyl)methylsulfanyl]-N,N-diethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3031212 |
| Molecular Formula | C14H22Cl3NS |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylsulfanyl]-N,N-diethylpropan-1-amine;hydrochloride |
| SMILES | CCN(CC)CCCSCc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C14H21Cl2NS.ClH/c1-3-17(4-2)8-5-9-18-11-12-6-7-13(15)10-14(12)16;/h6-7,10H,3-5,8-9,11H2,1-2H3;1H |
| InChIKey | NYVCSHDEARWYAZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|