About 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide
2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide (PubChem CID 900355) has the molecular formula C11H13Cl2NOS
and a molecular weight of 278.20 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide |
| PubChem CID | 900355 |
| Molecular Formula | C11H13Cl2NOS |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2NOS/c1-14(2)11(15)7-16-6-8-9(12)4-3-5-10(8)13/h3-5H,6-7H2,1-2H3 |
| InChIKey | XDXRTCWAJFAFQS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide?
The IUPAC name of 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide (CID 900355) is 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide is CN(C)C(=O)CSCc1c(Cl)cccc1Cl.
What is the InChIKey of 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide?
The InChIKey is XDXRTCWAJFAFQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NOS/c1-14(2)11(15)7-16-6-8-9(12)4-3-5-10(8)13/h3-5H,6-7H2,1-2H3.
What are the key properties of 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide?
2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide has a molecular weight of 278.20 g/mol, XLogP of 3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichlorophenyl)methylsulfanyl]-N,N-dimethylacetamide is sourced from PubChem (CID 900355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).