C9H9Cl2NOS — CID 893931
2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 893931) has the molecular formula C9H9Cl2NOS and a molecular weight of 250.15 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 893931 |
| Molecular Formula | C9H9Cl2NOS |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | NC(=O)CSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2NOS/c10-7-2-1-3-8(11)6(7)4-14-5-9(12)13/h1-3H,4-5H2,(H2,12,13) |
| InChIKey | JTNZOQSKSBVTCZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |