C9H10Cl2N2OS — CID 1483486
2-[(2,4-dichlorophenyl)methylsulfanyl]acetohydrazide (PubChem CID 1483486) has the molecular formula C9H10Cl2N2OS and a molecular weight of 265.17 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfanyl]acetohydrazide.
| Compound Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 1483486 |
| Molecular Formula | C9H10Cl2N2OS |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]acetohydrazide |
| SMILES | NNC(=O)CSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2N2OS/c10-7-2-1-6(8(11)3-7)4-15-5-9(14)13-12/h1-3H,4-5,12H2,(H,13,14) |
| InChIKey | DJPHAVXHYJUQKF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|