C9H8Cl2N2O — CID 5924112
(2E)-3-(2,4-dichlorophenyl)prop-2-enehydrazide (PubChem CID 5924112) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)prop-2-enehydrazide.
| Compound Name | (2E)-3-(2,4-dichlorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 5924112 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)prop-2-enehydrazide |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C=C/C(=O)NN |
| InChI | InChI=1S/C9H8Cl2N2O/c10-7-3-1-6(8(11)5-7)2-4-9(14)13-12/h1-5H,12H2,(H,13,14)/b4-2+ |
| InChIKey | WWOAAMJEUHUILM-DUXPYHPUSA-N |
| XLogP | 2.00 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 233 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|