C12H15Cl2NOS — CID 162663908
2-[(2,4-dichlorophenyl)methylsulfanyl]-3-methylbutanamide (PubChem CID 162663908) has the molecular formula C12H15Cl2NOS and a molecular weight of 292.23 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfanyl]-3-methylbutanamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 162663908 |
| Molecular Formula | C12H15Cl2NOS |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-3-methylbutanamide |
| SMILES | CC(C)C(SCc1ccc(Cl)cc1Cl)C(N)=O |
| InChI | InChI=1S/C12H15Cl2NOS/c1-7(2)11(12(15)16)17-6-8-3-4-9(13)5-10(8)14/h3-5,7,11H,6H2,1-2H3,(H2,15,16) |
| InChIKey | AUFCXAUHONVSJV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |