C14H17Cl2NOS — CID 162665282
2-cyclopentyl-2-[(3,5-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 162665282) has the molecular formula C14H17Cl2NOS and a molecular weight of 318.27 g/mol. Its IUPAC name is 2-cyclopentyl-2-[(3,5-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | 2-cyclopentyl-2-[(3,5-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 162665282 |
| Molecular Formula | C14H17Cl2NOS |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-cyclopentyl-2-[(3,5-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | NC(=O)C(SCc1cc(Cl)cc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C14H17Cl2NOS/c15-11-5-9(6-12(16)7-11)8-19-13(14(17)18)10-3-1-2-4-10/h5-7,10,13H,1-4,8H2,(H2,17,18) |
| InChIKey | IEPIBOBZWHSCSG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |