C17H22Cl2O5S — CID 10597619
2-[6-(2,4-dichlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid (PubChem CID 10597619) has the molecular formula C17H22Cl2O5S and a molecular weight of 409.33 g/mol. Its IUPAC name is 2-[6-(2,4-dichlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[6-(2,4-dichlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 10597619 |
| Molecular Formula | C17H22Cl2O5S |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-[6-(2,4-dichlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CSCCCCCCc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C17H22Cl2O5S/c18-13-7-6-12(14(19)9-13)5-3-1-2-4-8-25-11-17(24,16(22)23)10-15(20)21/h6-7,9,24H,1-5,8,10-11H2,(H,20,21)(H,22,23) |
| InChIKey | QGRRMRPIDRCWTG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|