C14H16Cl2O5S — CID 102000554
(2S)-2-[3-(2,4-dichlorophenyl)propylsulfanylmethyl]-2-hydroxybutanedioic acid (PubChem CID 102000554) has the molecular formula C14H16Cl2O5S and a molecular weight of 367.25 g/mol. Its IUPAC name is (2S)-2-[3-(2,4-dichlorophenyl)propylsulfanylmethyl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[3-(2,4-dichlorophenyl)propylsulfanylmethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 102000554 |
| Molecular Formula | C14H16Cl2O5S |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | (2S)-2-[3-(2,4-dichlorophenyl)propylsulfanylmethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)C[C@@](O)(CSCCCc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C14H16Cl2O5S/c15-10-4-3-9(11(16)6-10)2-1-5-22-8-14(21,13(19)20)7-12(17)18/h3-4,6,21H,1-2,5,7-8H2,(H,17,18)(H,19,20)/t14-/m1/s1 |
| InChIKey | ITLFLRQRHMHRIQ-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|