C14H19Cl2NO2 — CID 91048195
tert-butyl N-[3-(2,4-dichlorophenyl)propyl]carbamate (PubChem CID 91048195) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is tert-butyl N-[3-(2,4-dichlorophenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,4-dichlorophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 91048195 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | tert-butyl N-[3-(2,4-dichlorophenyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2/c1-14(2,3)19-13(18)17-8-4-5-10-6-7-11(15)9-12(10)16/h6-7,9H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | QMZVMAOJTDPOPM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|