C14H19ClINO3 — CID 164607116
tert-butyl N-[3-(4-chloro-2-iodophenoxy)propyl]carbamate (PubChem CID 164607116) has the molecular formula C14H19ClINO3 and a molecular weight of 411.67 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloro-2-iodophenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloro-2-iodophenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 164607116 |
| Molecular Formula | C14H19ClINO3 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | tert-butyl N-[3-(4-chloro-2-iodophenoxy)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(Cl)cc1I |
| InChI | InChI=1S/C14H19ClINO3/c1-14(2,3)20-13(18)17-7-4-8-19-12-6-5-10(15)9-11(12)16/h5-6,9H,4,7-8H2,1-3H3,(H,17,18) |
| InChIKey | NIXDMTUHARWUKJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|