C15H19ClFNO5 — CID 90008210
methyl 4-chloro-2-fluoro-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoate (PubChem CID 90008210) has the molecular formula C15H19ClFNO5 and a molecular weight of 347.77 g/mol. Its IUPAC name is methyl 4-chloro-2-fluoro-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoate.
| Compound Name | methyl 4-chloro-2-fluoro-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoate |
|---|---|
| PubChem CID | 90008210 |
| Molecular Formula | C15H19ClFNO5 |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | methyl 4-chloro-2-fluoro-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoate |
| SMILES | COC(=O)c1c(F)cc(Cl)cc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19ClFNO5/c1-15(2,3)23-14(20)18-5-6-22-11-8-9(16)7-10(17)12(11)13(19)21-4/h7-8H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | VTHIYPYCHWPXTL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|