C13H17ClINO3 — CID 175686847
tert-butyl N-[2-(5-chloro-2-iodophenoxy)ethyl]carbamate (PubChem CID 175686847) has the molecular formula C13H17ClINO3 and a molecular weight of 397.64 g/mol. Its IUPAC name is tert-butyl N-[2-(5-chloro-2-iodophenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-chloro-2-iodophenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 175686847 |
| Molecular Formula | C13H17ClINO3 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | tert-butyl N-[2-(5-chloro-2-iodophenoxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc(Cl)ccc1I |
| InChI | InChI=1S/C13H17ClINO3/c1-13(2,3)19-12(17)16-6-7-18-11-8-9(14)4-5-10(11)15/h4-5,8H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | BXDSKPGEARRRBC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|