C15H19NO7 — CID 122438342
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]terephthalic acid (PubChem CID 122438342) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]terephthalic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]terephthalic acid |
|---|---|
| PubChem CID | 122438342 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]terephthalic acid |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc(C(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C15H19NO7/c1-15(2,3)23-14(21)16-6-7-22-11-8-9(12(17)18)4-5-10(11)13(19)20/h4-5,8H,6-7H2,1-3H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | NOSXBFCXLKJUJL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|