C31H52N4O9 — CID 131994884
5-[2-(methylamino)ethylcarbamoyl]-2,4-bis[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]benzoic acid (PubChem CID 131994884) has the molecular formula C31H52N4O9 and a molecular weight of 624.78 g/mol. Its IUPAC name is 5-[2-(methylamino)ethylcarbamoyl]-2,4-bis[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]benzoic acid.
| Compound Name | 5-[2-(methylamino)ethylcarbamoyl]-2,4-bis[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]benzoic acid |
|---|---|
| PubChem CID | 131994884 |
| Molecular Formula | C31H52N4O9 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | 5-[2-(methylamino)ethylcarbamoyl]-2,4-bis[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]benzoic acid |
| SMILES | CNCCNC(=O)c1cc(C(=O)O)c(OCCCCCNC(=O)OC(C)(C)C)cc1OCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H52N4O9/c1-30(2,3)43-28(39)34-14-10-8-12-18-41-24-21-25(23(27(37)38)20-22(24)26(36)33-17-16-32-7)42-19-13-9-11-15-35-29(40)44-31(4,5)6/h20-21,32H,8-19H2,1-7H3,(H,33,36)(H,34,39)(H,35,40)(H,37,38) |
| InChIKey | NBSDJPXBQBNNSP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 173.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|