C27H46N4O6 — CID 122425730
tert-butyl N-[5-[4-carbamoyl-5-hexoxy-2-[2-(methylamino)ethylcarbamoyl]phenoxy]pentyl]carbamate (PubChem CID 122425730) has the molecular formula C27H46N4O6 and a molecular weight of 522.69 g/mol. Its IUPAC name is tert-butyl N-[5-[4-carbamoyl-5-hexoxy-2-[2-(methylamino)ethylcarbamoyl]phenoxy]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-carbamoyl-5-hexoxy-2-[2-(methylamino)ethylcarbamoyl]phenoxy]pentyl]carbamate |
|---|---|
| PubChem CID | 122425730 |
| Molecular Formula | C27H46N4O6 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | tert-butyl N-[5-[4-carbamoyl-5-hexoxy-2-[2-(methylamino)ethylcarbamoyl]phenoxy]pentyl]carbamate |
| SMILES | CCCCCCOc1cc(OCCCCCNC(=O)OC(C)(C)C)c(C(=O)NCCNC)cc1C(N)=O |
| InChI | InChI=1S/C27H46N4O6/c1-6-7-8-11-16-35-22-19-23(21(18-20(22)24(28)32)25(33)30-15-14-29-5)36-17-12-9-10-13-31-26(34)37-27(2,3)4/h18-19,29H,6-17H2,1-5H3,(H2,28,32)(H,30,33)(H,31,34) |
| InChIKey | YYKLSKPUAUURKJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|