C26H43NO6 — CID 121440206
2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-4-octoxybenzoic acid (PubChem CID 121440206) has the molecular formula C26H43NO6 and a molecular weight of 465.63 g/mol. Its IUPAC name is 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-4-octoxybenzoic acid.
| Compound Name | 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-4-octoxybenzoic acid |
|---|---|
| PubChem CID | 121440206 |
| Molecular Formula | C26H43NO6 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-4-octoxybenzoic acid |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)c(OCCCCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H43NO6/c1-5-6-7-8-10-13-18-31-21-15-16-22(24(28)29)23(20-21)32-19-14-11-9-12-17-27-25(30)33-26(2,3)4/h15-16,20H,5-14,17-19H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | IGBFLSOITMQJMW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|