C16H22N2O6S — CID 70319518
2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-5-sulfanylphenoxy]acetic acid (PubChem CID 70319518) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-5-sulfanylphenoxy]acetic acid.
| Compound Name | 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-5-sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 70319518 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-5-sulfanylphenoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1ccc(S)cc1OCC(=O)O |
| InChI | InChI=1S/C16H22N2O6S/c1-16(2,3)24-15(22)18-7-6-17-14(21)11-5-4-10(25)8-12(11)23-9-13(19)20/h4-5,8,25H,6-7,9H2,1-3H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | ZNLXHRLVOVDGKU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|