C11H12FNO4 — CID 171396499
2-[2-(ethylcarbamoyl)-5-fluorophenoxy]acetic acid (PubChem CID 171396499) has the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. Its IUPAC name is 2-[2-(ethylcarbamoyl)-5-fluorophenoxy]acetic acid.
| Compound Name | 2-[2-(ethylcarbamoyl)-5-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 171396499 |
| Molecular Formula | C11H12FNO4 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-[2-(ethylcarbamoyl)-5-fluorophenoxy]acetic acid |
| SMILES | CCNC(=O)c1ccc(F)cc1OCC(=O)O |
| InChI | InChI=1S/C11H12FNO4/c1-2-13-11(16)8-4-3-7(12)5-9(8)17-6-10(14)15/h3-5H,2,6H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | PUKBKCUBZMZIQU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |