C9H10FNO2 — CID 79531934
N-ethyl-5-fluoro-2-hydroxybenzamide (PubChem CID 79531934) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is N-ethyl-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-ethyl-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 79531934 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | N-ethyl-5-fluoro-2-hydroxybenzamide |
| SMILES | CCNC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C9H10FNO2/c1-2-11-9(13)7-5-6(10)3-4-8(7)12/h3-5,12H,2H2,1H3,(H,11,13) |
| InChIKey | BEJRXHUXCWQRKZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |