C9H10FNO3 — CID 67742481
5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide (PubChem CID 67742481) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide.
| Compound Name | 5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 67742481 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1cc(F)ccc1O |
| InChI | InChI=1S/C9H10FNO3/c10-6-1-2-8(13)7(5-6)9(14)11-3-4-12/h1-2,5,12-13H,3-4H2,(H,11,14) |
| InChIKey | HTFQIHVNSBKGQT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |