C10H9BrFNO2 — CID 115681931
N-(2-bromoprop-2-enyl)-5-fluoro-2-hydroxybenzamide (PubChem CID 115681931) has the molecular formula C10H9BrFNO2 and a molecular weight of 274.09 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-(2-bromoprop-2-enyl)-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 115681931 |
| Molecular Formula | C10H9BrFNO2 |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-5-fluoro-2-hydroxybenzamide |
| SMILES | C=C(Br)CNC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C10H9BrFNO2/c1-6(11)5-13-10(15)8-4-7(12)2-3-9(8)14/h2-4,14H,1,5H2,(H,13,15) |
| InChIKey | CAKZZFHPIBTXMF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |