C10H9BrClNO2 — CID 115595089
N-(2-bromoprop-2-enyl)-4-chloro-2-hydroxybenzamide (PubChem CID 115595089) has the molecular formula C10H9BrClNO2 and a molecular weight of 290.54 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-4-chloro-2-hydroxybenzamide.
| Compound Name | N-(2-bromoprop-2-enyl)-4-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 115595089 |
| Molecular Formula | C10H9BrClNO2 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-4-chloro-2-hydroxybenzamide |
| SMILES | C=C(Br)CNC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C10H9BrClNO2/c1-6(11)5-13-10(15)8-3-2-7(12)4-9(8)14/h2-4,14H,1,5H2,(H,13,15) |
| InChIKey | YCFOUZLFEHBKTF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |