C12H15Cl2NO2 — CID 115364597
4-chloro-N-(3-chloro-2,2-dimethylpropyl)-2-hydroxybenzamide (PubChem CID 115364597) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-2,2-dimethylpropyl)-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-(3-chloro-2,2-dimethylpropyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 115364597 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-chloro-N-(3-chloro-2,2-dimethylpropyl)-2-hydroxybenzamide |
| SMILES | CC(C)(CCl)CNC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H15Cl2NO2/c1-12(2,6-13)7-15-11(17)9-4-3-8(14)5-10(9)16/h3-5,16H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | GDNWICJJAPOAGY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|