C12H14Cl3NO2 — CID 107867828
4-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-2-hydroxybenzamide (PubChem CID 107867828) has the molecular formula C12H14Cl3NO2 and a molecular weight of 310.61 g/mol. Its IUPAC name is 4-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 107867828 |
| Molecular Formula | C12H14Cl3NO2 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 4-chloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]-2-hydroxybenzamide |
| SMILES | CCC(CCl)(CCl)NC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H14Cl3NO2/c1-2-12(6-13,7-14)16-11(18)9-4-3-8(15)5-10(9)17/h3-5,17H,2,6-7H2,1H3,(H,16,18) |
| InChIKey | IZGXEHJYFQVCOM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|