C12H13Cl2F2NO — CID 114010884
N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,3-difluorobenzamide (PubChem CID 114010884) has the molecular formula C12H13Cl2F2NO and a molecular weight of 296.14 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,3-difluorobenzamide.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 114010884 |
| Molecular Formula | C12H13Cl2F2NO |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-2,3-difluorobenzamide |
| SMILES | CCC(CCl)(CCl)NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H13Cl2F2NO/c1-2-12(6-13,7-14)17-11(18)8-4-3-5-9(15)10(8)16/h3-5H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | NHLPAIDKXPTSHP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|