C13H15Cl2F2NO — CID 82771535
4-chloro-N-[3-(chloromethyl)pentan-3-yl]-2,5-difluorobenzamide (PubChem CID 82771535) has the molecular formula C13H15Cl2F2NO and a molecular weight of 310.17 g/mol. Its IUPAC name is 4-chloro-N-[3-(chloromethyl)pentan-3-yl]-2,5-difluorobenzamide.
| Compound Name | 4-chloro-N-[3-(chloromethyl)pentan-3-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82771535 |
| Molecular Formula | C13H15Cl2F2NO |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 4-chloro-N-[3-(chloromethyl)pentan-3-yl]-2,5-difluorobenzamide |
| SMILES | CCC(CC)(CCl)NC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H15Cl2F2NO/c1-3-13(4-2,7-14)18-12(19)8-5-11(17)9(15)6-10(8)16/h5-6H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | YUBZKCIXVVDPQH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|