C11H12ClF2NO2 — CID 82771628
4-chloro-2,5-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzamide (PubChem CID 82771628) has the molecular formula C11H12ClF2NO2 and a molecular weight of 263.67 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 82771628 |
| Molecular Formula | C11H12ClF2NO2 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzamide |
| SMILES | CC(C)(CO)NC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C11H12ClF2NO2/c1-11(2,5-16)15-10(17)6-3-9(14)7(12)4-8(6)13/h3-4,16H,5H2,1-2H3,(H,15,17) |
| InChIKey | JLEMXOBGBVAROX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|