C12H12ClF2NO3 — CID 64672306
3-[(2-chloro-4,5-difluorobenzoyl)amino]-3-methylbutanoic acid (PubChem CID 64672306) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-3-methylbutanoic acid.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 64672306 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H12ClF2NO3/c1-12(2,5-10(17)18)16-11(19)6-3-8(14)9(15)4-7(6)13/h3-4H,5H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | KCFKSFPOMOVVQK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|