C11H7ClF5NO3 — CID 79791903
2-[(2-chloro-4,5-difluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79791903) has the molecular formula C11H7ClF5NO3 and a molecular weight of 331.62 g/mol. Its IUPAC name is 2-[(2-chloro-4,5-difluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[(2-chloro-4,5-difluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79791903 |
| Molecular Formula | C11H7ClF5NO3 |
| Molecular Weight | 331.62 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-[(2-chloro-4,5-difluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | CC(NC(=O)c1cc(F)c(F)cc1Cl)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H7ClF5NO3/c1-10(9(20)21,11(15,16)17)18-8(19)4-2-6(13)7(14)3-5(4)12/h2-3H,1H3,(H,18,19)(H,20,21) |
| InChIKey | VFKQXBZJNIOOBN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|