C11H10F4N2O3 — CID 103871135
2-[(4-amino-2-fluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 103871135) has the molecular formula C11H10F4N2O3 and a molecular weight of 294.20 g/mol. Its IUPAC name is 2-[(4-amino-2-fluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[(4-amino-2-fluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 103871135 |
| Molecular Formula | C11H10F4N2O3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[(4-amino-2-fluorobenzoyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | CC(NC(=O)c1ccc(N)cc1F)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H10F4N2O3/c1-10(9(19)20,11(13,14)15)17-8(18)6-3-2-5(16)4-7(6)12/h2-4H,16H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | FQHXFUTVJGKNTO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|