C13H14ClF2NO3 — CID 79807166
2-[(2-chloro-4,5-difluorobenzoyl)amino]-2-ethylbutanoic acid (PubChem CID 79807166) has the molecular formula C13H14ClF2NO3 and a molecular weight of 305.71 g/mol. Its IUPAC name is 2-[(2-chloro-4,5-difluorobenzoyl)amino]-2-ethylbutanoic acid.
| Compound Name | 2-[(2-chloro-4,5-difluorobenzoyl)amino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 79807166 |
| Molecular Formula | C13H14ClF2NO3 |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[(2-chloro-4,5-difluorobenzoyl)amino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(NC(=O)c1cc(F)c(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14ClF2NO3/c1-3-13(4-2,12(19)20)17-11(18)7-5-9(15)10(16)6-8(7)14/h5-6H,3-4H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | SGMJTRYNUYGSBP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|