C13H16ClF2NO2 — CID 82773237
4-chloro-2,5-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide (PubChem CID 82773237) has the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide |
|---|---|
| PubChem CID | 82773237 |
| Molecular Formula | C13H16ClF2NO2 |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide |
| SMILES | CCC(CC)(CO)NC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H16ClF2NO2/c1-3-13(4-2,7-18)17-12(19)8-5-11(16)9(14)6-10(8)15/h5-6,18H,3-4,7H2,1-2H3,(H,17,19) |
| InChIKey | JDAQDOVYTZEUQD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|